C25H21N3O5 — CID 10003513
4-[[6-[[2-(4-methoxyphenyl)acetyl]amino]-4-oxoquinazolin-3-yl]methyl]benzoic acid (PubChem CID 10003513) has the molecular formula C25H21N3O5 and a molecular weight of 443.46 g/mol. Its IUPAC name is 4-[[6-[[2-(4-methoxyphenyl)acetyl]amino]-4-oxoquinazolin-3-yl]methyl]benzoic acid.
| Compound Name | 4-[[6-[[2-(4-methoxyphenyl)acetyl]amino]-4-oxoquinazolin-3-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 10003513 |
| Molecular Formula | C25H21N3O5 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 4-[[6-[[2-(4-methoxyphenyl)acetyl]amino]-4-oxoquinazolin-3-yl]methyl]benzoic acid |
| SMILES | COc1ccc(CC(=O)Nc2ccc3ncn(Cc4ccc(C(=O)O)cc4)c(=O)c3c2)cc1 |
| InChI | InChI=1S/C25H21N3O5/c1-33-20-9-4-16(5-10-20)12-23(29)27-19-8-11-22-21(13-19)24(30)28(15-26-22)14-17-2-6-18(7-3-17)25(31)32/h2-11,13,15H,12,14H2,1H3,(H,27,29)(H,31,32) |
| InChIKey | FIGLODNTFSLAOE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |