C17H11Cl2N3O4 — CID 44574768
2-[[3-[(3,4-dichlorophenyl)methyl]-4-oxoquinazolin-6-yl]amino]-2-oxoacetic acid (PubChem CID 44574768) has the molecular formula C17H11Cl2N3O4 and a molecular weight of 392.20 g/mol. Its IUPAC name is 2-[[3-[(3,4-dichlorophenyl)methyl]-4-oxoquinazolin-6-yl]amino]-2-oxoacetic acid.
| Compound Name | 2-[[3-[(3,4-dichlorophenyl)methyl]-4-oxoquinazolin-6-yl]amino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 44574768 |
| Molecular Formula | C17H11Cl2N3O4 |
| Molecular Weight | 392.20 g/mol |
| Exact Mass | 391.01 |
| IUPAC Name | 2-[[3-[(3,4-dichlorophenyl)methyl]-4-oxoquinazolin-6-yl]amino]-2-oxoacetic acid |
| SMILES | O=C(O)C(=O)Nc1ccc2ncn(Cc3ccc(Cl)c(Cl)c3)c(=O)c2c1 |
| InChI | InChI=1S/C17H11Cl2N3O4/c18-12-3-1-9(5-13(12)19)7-22-8-20-14-4-2-10(6-11(14)16(22)24)21-15(23)17(25)26/h1-6,8H,7H2,(H,21,23)(H,25,26) |
| InChIKey | ZFQYHUXDDOLXRV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.20 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|