C19H15ClFN3O4 — CID 25158458
[2-[[3-[(3-chloro-4-fluorophenyl)methyl]-4-oxoquinazolin-7-yl]amino]-2-oxoethyl] acetate (PubChem CID 25158458) has the molecular formula C19H15ClFN3O4 and a molecular weight of 403.80 g/mol. Its IUPAC name is [2-[[3-[(3-chloro-4-fluorophenyl)methyl]-4-oxoquinazolin-7-yl]amino]-2-oxoethyl] acetate.
| Compound Name | [2-[[3-[(3-chloro-4-fluorophenyl)methyl]-4-oxoquinazolin-7-yl]amino]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 25158458 |
| Molecular Formula | C19H15ClFN3O4 |
| Molecular Weight | 403.80 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | [2-[[3-[(3-chloro-4-fluorophenyl)methyl]-4-oxoquinazolin-7-yl]amino]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)Nc1ccc2c(=O)n(Cc3ccc(F)c(Cl)c3)cnc2c1 |
| InChI | InChI=1S/C19H15ClFN3O4/c1-11(25)28-9-18(26)23-13-3-4-14-17(7-13)22-10-24(19(14)27)8-12-2-5-16(21)15(20)6-12/h2-7,10H,8-9H2,1H3,(H,23,26) |
| InChIKey | UEQIWXBRYCQNCQ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.80 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |