C18H16ClFN4O3 — CID 162429270
1-(3-chloro-4-fluorophenyl)-3-[3-(2-methoxyethyl)-4-oxoquinazolin-6-yl]urea (PubChem CID 162429270) has the molecular formula C18H16ClFN4O3 and a molecular weight of 390.80 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-[3-(2-methoxyethyl)-4-oxoquinazolin-6-yl]urea.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-[3-(2-methoxyethyl)-4-oxoquinazolin-6-yl]urea |
|---|---|
| PubChem CID | 162429270 |
| Molecular Formula | C18H16ClFN4O3 |
| Molecular Weight | 390.80 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-[3-(2-methoxyethyl)-4-oxoquinazolin-6-yl]urea |
| SMILES | COCCn1cnc2ccc(NC(=O)Nc3ccc(F)c(Cl)c3)cc2c1=O |
| InChI | InChI=1S/C18H16ClFN4O3/c1-27-7-6-24-10-21-16-5-3-11(8-13(16)17(24)25)22-18(26)23-12-2-4-15(20)14(19)9-12/h2-5,8-10H,6-7H2,1H3,(H2,22,23,26) |
| InChIKey | OYLNAPQDBCPWEV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.80 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |