C19H20N4O4 — CID 162429378
1-[3-(2-methoxyethyl)-4-oxoquinazolin-6-yl]-3-(3-methoxyphenyl)urea (PubChem CID 162429378) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is 1-[3-(2-methoxyethyl)-4-oxoquinazolin-6-yl]-3-(3-methoxyphenyl)urea.
| Compound Name | 1-[3-(2-methoxyethyl)-4-oxoquinazolin-6-yl]-3-(3-methoxyphenyl)urea |
|---|---|
| PubChem CID | 162429378 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 1-[3-(2-methoxyethyl)-4-oxoquinazolin-6-yl]-3-(3-methoxyphenyl)urea |
| SMILES | COCCn1cnc2ccc(NC(=O)Nc3cccc(OC)c3)cc2c1=O |
| InChI | InChI=1S/C19H20N4O4/c1-26-9-8-23-12-20-17-7-6-14(11-16(17)18(23)24)22-19(25)21-13-4-3-5-15(10-13)27-2/h3-7,10-12H,8-9H2,1-2H3,(H2,21,22,25) |
| InChIKey | ZRVMIPSWTRXABL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |