C19H17F3N4O4 — CID 162429621
1-[3-(2-methoxyethyl)-4-oxoquinazolin-6-yl]-3-[4-(trifluoromethoxy)phenyl]urea (PubChem CID 162429621) has the molecular formula C19H17F3N4O4 and a molecular weight of 422.36 g/mol. Its IUPAC name is 1-[3-(2-methoxyethyl)-4-oxoquinazolin-6-yl]-3-[4-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[3-(2-methoxyethyl)-4-oxoquinazolin-6-yl]-3-[4-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 162429621 |
| Molecular Formula | C19H17F3N4O4 |
| Molecular Weight | 422.36 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 1-[3-(2-methoxyethyl)-4-oxoquinazolin-6-yl]-3-[4-(trifluoromethoxy)phenyl]urea |
| SMILES | COCCn1cnc2ccc(NC(=O)Nc3ccc(OC(F)(F)F)cc3)cc2c1=O |
| InChI | InChI=1S/C19H17F3N4O4/c1-29-9-8-26-11-23-16-7-4-13(10-15(16)17(26)27)25-18(28)24-12-2-5-14(6-3-12)30-19(20,21)22/h2-7,10-11H,8-9H2,1H3,(H2,24,25,28) |
| InChIKey | NBPAENOFXSTNMO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.36 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |