C21H20F3N3O3 — CID 4899813
6-(4-oxoquinazolin-3-yl)-N-[4-(trifluoromethoxy)phenyl]hexanamide (PubChem CID 4899813) has the molecular formula C21H20F3N3O3 and a molecular weight of 419.40 g/mol. Its IUPAC name is 6-(4-oxoquinazolin-3-yl)-N-[4-(trifluoromethoxy)phenyl]hexanamide.
| Compound Name | 6-(4-oxoquinazolin-3-yl)-N-[4-(trifluoromethoxy)phenyl]hexanamide |
|---|---|
| PubChem CID | 4899813 |
| Molecular Formula | C21H20F3N3O3 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 6-(4-oxoquinazolin-3-yl)-N-[4-(trifluoromethoxy)phenyl]hexanamide |
| SMILES | O=C(CCCCCn1cnc2ccccc2c1=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C21H20F3N3O3/c22-21(23,24)30-16-11-9-15(10-12-16)26-19(28)8-2-1-5-13-27-14-25-18-7-4-3-6-17(18)20(27)29/h3-4,6-7,9-12,14H,1-2,5,8,13H2,(H,26,28) |
| InChIKey | CQGJRVGVEQMQEV-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|