C23H24N6O2 — CID 45494949
6-(4-oxoquinazolin-3-yl)-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]hexanamide (PubChem CID 45494949) has the molecular formula C23H24N6O2 and a molecular weight of 416.49 g/mol. Its IUPAC name is 6-(4-oxoquinazolin-3-yl)-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]hexanamide.
| Compound Name | 6-(4-oxoquinazolin-3-yl)-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]hexanamide |
|---|---|
| PubChem CID | 45494949 |
| Molecular Formula | C23H24N6O2 |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 6-(4-oxoquinazolin-3-yl)-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]hexanamide |
| SMILES | O=C(CCCCCn1cnc2ccccc2c1=O)Nc1ccc(Cn2cncn2)cc1 |
| InChI | InChI=1S/C23H24N6O2/c30-22(27-19-11-9-18(10-12-19)14-29-16-24-15-26-29)8-2-1-5-13-28-17-25-21-7-4-3-6-20(21)23(28)31/h3-4,6-7,9-12,15-17H,1-2,5,8,13-14H2,(H,27,30) |
| InChIKey | YPFWGMQZDBGVFX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 94.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|