C19H16F3N3O4 — CID 67376888
[4-oxo-3-[3-[2-(trifluoromethyl)phenoxy]propyl]quinazolin-6-yl]carbamic acid (PubChem CID 67376888) has the molecular formula C19H16F3N3O4 and a molecular weight of 407.35 g/mol. Its IUPAC name is [4-oxo-3-[3-[2-(trifluoromethyl)phenoxy]propyl]quinazolin-6-yl]carbamic acid.
| Compound Name | [4-oxo-3-[3-[2-(trifluoromethyl)phenoxy]propyl]quinazolin-6-yl]carbamic acid |
|---|---|
| PubChem CID | 67376888 |
| Molecular Formula | C19H16F3N3O4 |
| Molecular Weight | 407.35 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | [4-oxo-3-[3-[2-(trifluoromethyl)phenoxy]propyl]quinazolin-6-yl]carbamic acid |
| SMILES | O=C(O)Nc1ccc2ncn(CCCOc3ccccc3C(F)(F)F)c(=O)c2c1 |
| InChI | InChI=1S/C19H16F3N3O4/c20-19(21,22)14-4-1-2-5-16(14)29-9-3-8-25-11-23-15-7-6-12(24-18(27)28)10-13(15)17(25)26/h1-2,4-7,10-11,24H,3,8-9H2,(H,27,28) |
| InChIKey | UBAZDIYHWPZZAJ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.35 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|