C25H22FN3O4 — CID 46208552
benzyl N-[3-[3-(2-fluorophenoxy)propyl]-4-oxoquinazolin-6-yl]carbamate (PubChem CID 46208552) has the molecular formula C25H22FN3O4 and a molecular weight of 447.47 g/mol. Its IUPAC name is benzyl N-[3-[3-(2-fluorophenoxy)propyl]-4-oxoquinazolin-6-yl]carbamate.
| Compound Name | benzyl N-[3-[3-(2-fluorophenoxy)propyl]-4-oxoquinazolin-6-yl]carbamate |
|---|---|
| PubChem CID | 46208552 |
| Molecular Formula | C25H22FN3O4 |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | benzyl N-[3-[3-(2-fluorophenoxy)propyl]-4-oxoquinazolin-6-yl]carbamate |
| SMILES | O=C(Nc1ccc2ncn(CCCOc3ccccc3F)c(=O)c2c1)OCc1ccccc1 |
| InChI | InChI=1S/C25H22FN3O4/c26-21-9-4-5-10-23(21)32-14-6-13-29-17-27-22-12-11-19(15-20(22)24(29)30)28-25(31)33-16-18-7-2-1-3-8-18/h1-5,7-12,15,17H,6,13-14,16H2,(H,28,31) |
| InChIKey | VSTIRTAQKJYNEU-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|