C24H27BrFN3O4 — CID 170387977
benzyl N-[2-[5-(7-bromo-6-fluoro-4-oxoquinazolin-3-yl)pentoxy]propan-2-yl]carbamate (PubChem CID 170387977) has the molecular formula C24H27BrFN3O4 and a molecular weight of 520.40 g/mol. Its IUPAC name is benzyl N-[2-[5-(7-bromo-6-fluoro-4-oxoquinazolin-3-yl)pentoxy]propan-2-yl]carbamate.
| Compound Name | benzyl N-[2-[5-(7-bromo-6-fluoro-4-oxoquinazolin-3-yl)pentoxy]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 170387977 |
| Molecular Formula | C24H27BrFN3O4 |
| Molecular Weight | 520.40 g/mol |
| Exact Mass | 519.12 |
| IUPAC Name | benzyl N-[2-[5-(7-bromo-6-fluoro-4-oxoquinazolin-3-yl)pentoxy]propan-2-yl]carbamate |
| SMILES | CC(C)(NC(=O)OCc1ccccc1)OCCCCCn1cnc2cc(Br)c(F)cc2c1=O |
| InChI | InChI=1S/C24H27BrFN3O4/c1-24(2,28-23(31)32-15-17-9-5-3-6-10-17)33-12-8-4-7-11-29-16-27-21-14-19(25)20(26)13-18(21)22(29)30/h3,5-6,9-10,13-14,16H,4,7-8,11-12,15H2,1-2H3,(H,28,31) |
| InChIKey | ICWFDHIHPVPVRP-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.40 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|