C17H21BrClN3O4 — CID 154701146
5-(7-bromo-6-chloro-4-oxoquinazolin-3-yl)pentyl (2S,3R)-2-amino-3-hydroxybutanoate (PubChem CID 154701146) has the molecular formula C17H21BrClN3O4 and a molecular weight of 446.73 g/mol. Its IUPAC name is 5-(7-bromo-6-chloro-4-oxoquinazolin-3-yl)pentyl (2S,3R)-2-amino-3-hydroxybutanoate.
| Compound Name | 5-(7-bromo-6-chloro-4-oxoquinazolin-3-yl)pentyl (2S,3R)-2-amino-3-hydroxybutanoate |
|---|---|
| PubChem CID | 154701146 |
| Molecular Formula | C17H21BrClN3O4 |
| Molecular Weight | 446.73 g/mol |
| Exact Mass | 445.04 |
| IUPAC Name | 5-(7-bromo-6-chloro-4-oxoquinazolin-3-yl)pentyl (2S,3R)-2-amino-3-hydroxybutanoate |
| SMILES | C[C@@H](O)[C@H](N)C(=O)OCCCCCn1cnc2cc(Br)c(Cl)cc2c1=O |
| InChI | InChI=1S/C17H21BrClN3O4/c1-10(23)15(20)17(25)26-6-4-2-3-5-22-9-21-14-8-12(18)13(19)7-11(14)16(22)24/h7-10,15,23H,2-6,20H2,1H3/t10-,15+/m1/s1 |
| InChIKey | STFFHZKFSKKMRC-BMIGLBTASA-N |
| XLogP | 2.23 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.73 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|