C19H18F5N5O2 — CID 169118331
7-[4-amino-5-(difluoromethyl)pyrimidin-2-yl]-3-[5-(difluoromethoxy)pentyl]-6-fluoroquinazolin-4-one (PubChem CID 169118331) has the molecular formula C19H18F5N5O2 and a molecular weight of 443.38 g/mol. Its IUPAC name is 7-[4-amino-5-(difluoromethyl)pyrimidin-2-yl]-3-[5-(difluoromethoxy)pentyl]-6-fluoroquinazolin-4-one.
| Compound Name | 7-[4-amino-5-(difluoromethyl)pyrimidin-2-yl]-3-[5-(difluoromethoxy)pentyl]-6-fluoroquinazolin-4-one |
|---|---|
| PubChem CID | 169118331 |
| Molecular Formula | C19H18F5N5O2 |
| Molecular Weight | 443.38 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 7-[4-amino-5-(difluoromethyl)pyrimidin-2-yl]-3-[5-(difluoromethoxy)pentyl]-6-fluoroquinazolin-4-one |
| SMILES | Nc1nc(-c2cc3ncn(CCCCCOC(F)F)c(=O)c3cc2F)ncc1C(F)F |
| InChI | InChI=1S/C19H18F5N5O2/c20-13-6-11-14(7-10(13)17-26-8-12(15(21)22)16(25)28-17)27-9-29(18(11)30)4-2-1-3-5-31-19(23)24/h6-9,15,19H,1-5H2,(H2,25,26,28) |
| InChIKey | UEIIAGMRFTXTRE-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|