C11H13N3O3 — CID 162429544
6-(hydroxyamino)-3-(2-methoxyethyl)quinazolin-4-one (PubChem CID 162429544) has the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. Its IUPAC name is 6-(hydroxyamino)-3-(2-methoxyethyl)quinazolin-4-one.
| Compound Name | 6-(hydroxyamino)-3-(2-methoxyethyl)quinazolin-4-one |
|---|---|
| PubChem CID | 162429544 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 6-(hydroxyamino)-3-(2-methoxyethyl)quinazolin-4-one |
| SMILES | COCCn1cnc2ccc(NO)cc2c1=O |
| InChI | InChI=1S/C11H13N3O3/c1-17-5-4-14-7-12-10-3-2-8(13-16)6-9(10)11(14)15/h2-3,6-7,13,16H,4-5H2,1H3 |
| InChIKey | BQEAQWZVAWUXNP-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|