C21H27N5O4S — CID 132992824
5-[(4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[3-(2-methoxyethyl)-4-oxoquinazolin-6-yl]pentanamide (PubChem CID 132992824) has the molecular formula C21H27N5O4S and a molecular weight of 445.55 g/mol. Its IUPAC name is 5-[(4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[3-(2-methoxyethyl)-4-oxoquinazolin-6-yl]pentanamide.
| Compound Name | 5-[(4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[3-(2-methoxyethyl)-4-oxoquinazolin-6-yl]pentanamide |
|---|---|
| PubChem CID | 132992824 |
| Molecular Formula | C21H27N5O4S |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | 5-[(4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[3-(2-methoxyethyl)-4-oxoquinazolin-6-yl]pentanamide |
| SMILES | COCCn1cnc2ccc(NC(=O)CCCC[C@@H]3SC[C@@H]4NC(=O)NC43)cc2c1=O |
| InChI | InChI=1S/C21H27N5O4S/c1-30-9-8-26-12-22-15-7-6-13(10-14(15)20(26)28)23-18(27)5-3-2-4-17-19-16(11-31-17)24-21(29)25-19/h6-7,10,12,16-17,19H,2-5,8-9,11H2,1H3,(H,23,27)(H2,24,25,29)/t16-,17-,19?/m0/s1 |
| InChIKey | QQWYODDHSCFEAZ-YGYNJSFOSA-N |
| XLogP | 1.71 |
| TPSA | 114.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|