C18H13F2N3O4 — CID 7995448
[2-(3,4-difluoroanilino)-2-oxoethyl] 2-(4-oxoquinazolin-3-yl)acetate (PubChem CID 7995448) has the molecular formula C18H13F2N3O4 and a molecular weight of 373.32 g/mol. Its IUPAC name is [2-(3,4-difluoroanilino)-2-oxoethyl] 2-(4-oxoquinazolin-3-yl)acetate.
| Compound Name | [2-(3,4-difluoroanilino)-2-oxoethyl] 2-(4-oxoquinazolin-3-yl)acetate |
|---|---|
| PubChem CID | 7995448 |
| Molecular Formula | C18H13F2N3O4 |
| Molecular Weight | 373.32 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | [2-(3,4-difluoroanilino)-2-oxoethyl] 2-(4-oxoquinazolin-3-yl)acetate |
| SMILES | O=C(COC(=O)Cn1cnc2ccccc2c1=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H13F2N3O4/c19-13-6-5-11(7-14(13)20)22-16(24)9-27-17(25)8-23-10-21-15-4-2-1-3-12(15)18(23)26/h1-7,10H,8-9H2,(H,22,24) |
| InChIKey | BZQUYQKUZXZVBA-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.32 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |