C29H29N3O5 — CID 2451728
[2-[4-[4-(2-methylbutan-2-yl)phenoxy]anilino]-2-oxoethyl] 2-(4-oxoquinazolin-3-yl)acetate (PubChem CID 2451728) has the molecular formula C29H29N3O5 and a molecular weight of 499.57 g/mol. Its IUPAC name is [2-[4-[4-(2-methylbutan-2-yl)phenoxy]anilino]-2-oxoethyl] 2-(4-oxoquinazolin-3-yl)acetate.
| Compound Name | [2-[4-[4-(2-methylbutan-2-yl)phenoxy]anilino]-2-oxoethyl] 2-(4-oxoquinazolin-3-yl)acetate |
|---|---|
| PubChem CID | 2451728 |
| Molecular Formula | C29H29N3O5 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | [2-[4-[4-(2-methylbutan-2-yl)phenoxy]anilino]-2-oxoethyl] 2-(4-oxoquinazolin-3-yl)acetate |
| SMILES | CCC(C)(C)c1ccc(Oc2ccc(NC(=O)COC(=O)Cn3cnc4ccccc4c3=O)cc2)cc1 |
| InChI | InChI=1S/C29H29N3O5/c1-4-29(2,3)20-9-13-22(14-10-20)37-23-15-11-21(12-16-23)31-26(33)18-36-27(34)17-32-19-30-25-8-6-5-7-24(25)28(32)35/h5-16,19H,4,17-18H2,1-3H3,(H,31,33) |
| InChIKey | WSDCIAQZIFUTPP-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |