C19H14ClF2N3O5 — CID 29458541
[2-[3-chloro-4-(difluoromethoxy)anilino]-2-oxoethyl] 2-(4-oxoquinazolin-3-yl)acetate (PubChem CID 29458541) has the molecular formula C19H14ClF2N3O5 and a molecular weight of 437.79 g/mol. Its IUPAC name is [2-[3-chloro-4-(difluoromethoxy)anilino]-2-oxoethyl] 2-(4-oxoquinazolin-3-yl)acetate.
| Compound Name | [2-[3-chloro-4-(difluoromethoxy)anilino]-2-oxoethyl] 2-(4-oxoquinazolin-3-yl)acetate |
|---|---|
| PubChem CID | 29458541 |
| Molecular Formula | C19H14ClF2N3O5 |
| Molecular Weight | 437.79 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | [2-[3-chloro-4-(difluoromethoxy)anilino]-2-oxoethyl] 2-(4-oxoquinazolin-3-yl)acetate |
| SMILES | O=C(COC(=O)Cn1cnc2ccccc2c1=O)Nc1ccc(OC(F)F)c(Cl)c1 |
| InChI | InChI=1S/C19H14ClF2N3O5/c20-13-7-11(5-6-15(13)30-19(21)22)24-16(26)9-29-17(27)8-25-10-23-14-4-2-1-3-12(14)18(25)28/h1-7,10,19H,8-9H2,(H,24,26) |
| InChIKey | JXZCKTJDPKQTSI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.79 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |