C19H15Cl2N3O4 — CID 33356940
[2-(2,6-dichloroanilino)-2-oxoethyl] 3-(4-oxoquinazolin-3-yl)propanoate (PubChem CID 33356940) has the molecular formula C19H15Cl2N3O4 and a molecular weight of 420.25 g/mol. Its IUPAC name is [2-(2,6-dichloroanilino)-2-oxoethyl] 3-(4-oxoquinazolin-3-yl)propanoate.
| Compound Name | [2-(2,6-dichloroanilino)-2-oxoethyl] 3-(4-oxoquinazolin-3-yl)propanoate |
|---|---|
| PubChem CID | 33356940 |
| Molecular Formula | C19H15Cl2N3O4 |
| Molecular Weight | 420.25 g/mol |
| Exact Mass | 419.04 |
| IUPAC Name | [2-(2,6-dichloroanilino)-2-oxoethyl] 3-(4-oxoquinazolin-3-yl)propanoate |
| SMILES | O=C(COC(=O)CCn1cnc2ccccc2c1=O)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C19H15Cl2N3O4/c20-13-5-3-6-14(21)18(13)23-16(25)10-28-17(26)8-9-24-11-22-15-7-2-1-4-12(15)19(24)27/h1-7,11H,8-10H2,(H,23,25) |
| InChIKey | NOXDXGXJOOQLFE-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.25 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |