C21H19Cl2N3O4S — CID 26983927
[2-(2,6-dichloroanilino)-2-oxoethyl] 3-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)propanoate (PubChem CID 26983927) has the molecular formula C21H19Cl2N3O4S and a molecular weight of 480.37 g/mol. Its IUPAC name is [2-(2,6-dichloroanilino)-2-oxoethyl] 3-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)propanoate.
| Compound Name | [2-(2,6-dichloroanilino)-2-oxoethyl] 3-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)propanoate |
|---|---|
| PubChem CID | 26983927 |
| Molecular Formula | C21H19Cl2N3O4S |
| Molecular Weight | 480.37 g/mol |
| Exact Mass | 479.05 |
| IUPAC Name | [2-(2,6-dichloroanilino)-2-oxoethyl] 3-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)propanoate |
| SMILES | O=C(COC(=O)CCn1cnc2sc3c(c2c1=O)CCCC3)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C21H19Cl2N3O4S/c22-13-5-3-6-14(23)19(13)25-16(27)10-30-17(28)8-9-26-11-24-20-18(21(26)29)12-4-1-2-7-15(12)31-20/h3,5-6,11H,1-2,4,7-10H2,(H,25,27) |
| InChIKey | VZSIYPCOEGMODT-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.37 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |