C22H22N4O2S2 — CID 1075277
3-[2-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)ethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 1075277) has the molecular formula C22H22N4O2S2 and a molecular weight of 438.58 g/mol. Its IUPAC name is 3-[2-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)ethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 3-[2-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)ethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 1075277 |
| Molecular Formula | C22H22N4O2S2 |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | 3-[2-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)ethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | O=c1c2c3c(sc2ncn1CCn1cnc2sc4c(c2c1=O)CCCC4)CCCC3 |
| InChI | InChI=1S/C22H22N4O2S2/c27-21-17-13-5-1-3-7-15(13)29-19(17)23-11-25(21)9-10-26-12-24-20-18(22(26)28)14-6-2-4-8-16(14)30-20/h11-12H,1-10H2 |
| InChIKey | UJVRHTGFSZEVGW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |