C14H14Cl2N2OS — CID 24626445
3-[(2,2-dichlorocyclopropyl)methyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 24626445) has the molecular formula C14H14Cl2N2OS and a molecular weight of 329.25 g/mol. Its IUPAC name is 3-[(2,2-dichlorocyclopropyl)methyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 3-[(2,2-dichlorocyclopropyl)methyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 24626445 |
| Molecular Formula | C14H14Cl2N2OS |
| Molecular Weight | 329.25 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | 3-[(2,2-dichlorocyclopropyl)methyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | O=c1c2c3c(sc2ncn1CC1CC1(Cl)Cl)CCCC3 |
| InChI | InChI=1S/C14H14Cl2N2OS/c15-14(16)5-8(14)6-18-7-17-12-11(13(18)19)9-3-1-2-4-10(9)20-12/h7-8H,1-6H2 |
| InChIKey | JDVXABINSDOJPL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.25 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|