C22H21N3O5 — CID 7995599
[2-oxo-2-[[(2S)-3-oxo-1-phenylbutan-2-yl]amino]ethyl] 2-(4-oxoquinazolin-3-yl)acetate (PubChem CID 7995599) has the molecular formula C22H21N3O5 and a molecular weight of 407.43 g/mol. Its IUPAC name is [2-oxo-2-[[(2S)-3-oxo-1-phenylbutan-2-yl]amino]ethyl] 2-(4-oxoquinazolin-3-yl)acetate.
| Compound Name | [2-oxo-2-[[(2S)-3-oxo-1-phenylbutan-2-yl]amino]ethyl] 2-(4-oxoquinazolin-3-yl)acetate |
|---|---|
| PubChem CID | 7995599 |
| Molecular Formula | C22H21N3O5 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | [2-oxo-2-[[(2S)-3-oxo-1-phenylbutan-2-yl]amino]ethyl] 2-(4-oxoquinazolin-3-yl)acetate |
| SMILES | CC(=O)[C@H](Cc1ccccc1)NC(=O)COC(=O)Cn1cnc2ccccc2c1=O |
| InChI | InChI=1S/C22H21N3O5/c1-15(26)19(11-16-7-3-2-4-8-16)24-20(27)13-30-21(28)12-25-14-23-18-10-6-5-9-17(18)22(25)29/h2-10,14,19H,11-13H2,1H3,(H,24,27)/t19-/m0/s1 |
| InChIKey | WHVKBAKHIPCAFG-IBGZPJMESA-N |
| XLogP | 1.26 |
| TPSA | 107.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |