C17H20N4O5 — CID 2482812
[2-(tert-butylcarbamoylamino)-2-oxoethyl] 2-(4-oxoquinazolin-3-yl)acetate (PubChem CID 2482812) has the molecular formula C17H20N4O5 and a molecular weight of 360.37 g/mol. Its IUPAC name is [2-(tert-butylcarbamoylamino)-2-oxoethyl] 2-(4-oxoquinazolin-3-yl)acetate.
| Compound Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl] 2-(4-oxoquinazolin-3-yl)acetate |
|---|---|
| PubChem CID | 2482812 |
| Molecular Formula | C17H20N4O5 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl] 2-(4-oxoquinazolin-3-yl)acetate |
| SMILES | CC(C)(C)NC(=O)NC(=O)COC(=O)Cn1cnc2ccccc2c1=O |
| InChI | InChI=1S/C17H20N4O5/c1-17(2,3)20-16(25)19-13(22)9-26-14(23)8-21-10-18-12-7-5-4-6-11(12)15(21)24/h4-7,10H,8-9H2,1-3H3,(H2,19,20,22,25) |
| InChIKey | KZMIIJKTOIXAGF-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |