C22H19N5O4 — CID 18279717
[2-[(5-methyl-2-phenylpyrazol-3-yl)amino]-2-oxoethyl] 2-(4-oxoquinazolin-3-yl)acetate (PubChem CID 18279717) has the molecular formula C22H19N5O4 and a molecular weight of 417.43 g/mol. Its IUPAC name is [2-[(5-methyl-2-phenylpyrazol-3-yl)amino]-2-oxoethyl] 2-(4-oxoquinazolin-3-yl)acetate.
| Compound Name | [2-[(5-methyl-2-phenylpyrazol-3-yl)amino]-2-oxoethyl] 2-(4-oxoquinazolin-3-yl)acetate |
|---|---|
| PubChem CID | 18279717 |
| Molecular Formula | C22H19N5O4 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | [2-[(5-methyl-2-phenylpyrazol-3-yl)amino]-2-oxoethyl] 2-(4-oxoquinazolin-3-yl)acetate |
| SMILES | Cc1cc(NC(=O)COC(=O)Cn2cnc3ccccc3c2=O)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C22H19N5O4/c1-15-11-19(27(25-15)16-7-3-2-4-8-16)24-20(28)13-31-21(29)12-26-14-23-18-10-6-5-9-17(18)22(26)30/h2-11,14H,12-13H2,1H3,(H,24,28) |
| InChIKey | LDZJTJPCQBHCKN-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 108.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |