C27H27N3O5 — CID 142804202
ethane;4-[[6-[(3-methoxyphenyl)methylcarbamoyl]-4-oxoquinazolin-3-yl]methyl]benzoic acid (PubChem CID 142804202) has the molecular formula C27H27N3O5 and a molecular weight of 473.53 g/mol. Its IUPAC name is ethane;4-[[6-[(3-methoxyphenyl)methylcarbamoyl]-4-oxoquinazolin-3-yl]methyl]benzoic acid.
| Compound Name | ethane;4-[[6-[(3-methoxyphenyl)methylcarbamoyl]-4-oxoquinazolin-3-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 142804202 |
| Molecular Formula | C27H27N3O5 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | ethane;4-[[6-[(3-methoxyphenyl)methylcarbamoyl]-4-oxoquinazolin-3-yl]methyl]benzoic acid |
| SMILES | CC.COc1cccc(CNC(=O)c2ccc3ncn(Cc4ccc(C(=O)O)cc4)c(=O)c3c2)c1 |
| InChI | InChI=1S/C25H21N3O5.C2H6/c1-33-20-4-2-3-17(11-20)13-26-23(29)19-9-10-22-21(12-19)24(30)28(15-27-22)14-16-5-7-18(8-6-16)25(31)32;1-2/h2-12,15H,13-14H2,1H3,(H,26,29)(H,31,32);1-2H3 |
| InChIKey | KWFHWNOUZZJFGI-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |