C23H19N3O4 — CID 118901622
N-hydroxy-4-oxo-3-[(3-phenylmethoxyphenyl)methyl]quinazoline-6-carboxamide (PubChem CID 118901622) has the molecular formula C23H19N3O4 and a molecular weight of 401.42 g/mol. Its IUPAC name is N-hydroxy-4-oxo-3-[(3-phenylmethoxyphenyl)methyl]quinazoline-6-carboxamide.
| Compound Name | N-hydroxy-4-oxo-3-[(3-phenylmethoxyphenyl)methyl]quinazoline-6-carboxamide |
|---|---|
| PubChem CID | 118901622 |
| Molecular Formula | C23H19N3O4 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | N-hydroxy-4-oxo-3-[(3-phenylmethoxyphenyl)methyl]quinazoline-6-carboxamide |
| SMILES | O=C(NO)c1ccc2ncn(Cc3cccc(OCc4ccccc4)c3)c(=O)c2c1 |
| InChI | InChI=1S/C23H19N3O4/c27-22(25-29)18-9-10-21-20(12-18)23(28)26(15-24-21)13-17-7-4-8-19(11-17)30-14-16-5-2-1-3-6-16/h1-12,15,29H,13-14H2,(H,25,27) |
| InChIKey | FPHRKHFSAIQRSQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|