C17H14FN3O3 — CID 90260365
3-[[3-(fluoromethyl)phenyl]methyl]-N-hydroxy-4-oxoquinazoline-6-carboxamide (PubChem CID 90260365) has the molecular formula C17H14FN3O3 and a molecular weight of 327.32 g/mol. Its IUPAC name is 3-[[3-(fluoromethyl)phenyl]methyl]-N-hydroxy-4-oxoquinazoline-6-carboxamide.
| Compound Name | 3-[[3-(fluoromethyl)phenyl]methyl]-N-hydroxy-4-oxoquinazoline-6-carboxamide |
|---|---|
| PubChem CID | 90260365 |
| Molecular Formula | C17H14FN3O3 |
| Molecular Weight | 327.32 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 3-[[3-(fluoromethyl)phenyl]methyl]-N-hydroxy-4-oxoquinazoline-6-carboxamide |
| SMILES | O=C(NO)c1ccc2ncn(Cc3cccc(CF)c3)c(=O)c2c1 |
| InChI | InChI=1S/C17H14FN3O3/c18-8-11-2-1-3-12(6-11)9-21-10-19-15-5-4-13(16(22)20-24)7-14(15)17(21)23/h1-7,10,24H,8-9H2,(H,20,22) |
| InChIKey | GHXWPBBYDHBAFD-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.32 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|