C28H22N4O3 — CID 139779480
4-oxo-N-(4-phenylmethoxyphenyl)-3-(pyridin-2-ylmethyl)quinazoline-7-carboxamide (PubChem CID 139779480) has the molecular formula C28H22N4O3 and a molecular weight of 462.51 g/mol. Its IUPAC name is 4-oxo-N-(4-phenylmethoxyphenyl)-3-(pyridin-2-ylmethyl)quinazoline-7-carboxamide.
| Compound Name | 4-oxo-N-(4-phenylmethoxyphenyl)-3-(pyridin-2-ylmethyl)quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 139779480 |
| Molecular Formula | C28H22N4O3 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | 4-oxo-N-(4-phenylmethoxyphenyl)-3-(pyridin-2-ylmethyl)quinazoline-7-carboxamide |
| SMILES | O=C(Nc1ccc(OCc2ccccc2)cc1)c1ccc2c(=O)n(Cc3ccccn3)cnc2c1 |
| InChI | InChI=1S/C28H22N4O3/c33-27(31-22-10-12-24(13-11-22)35-18-20-6-2-1-3-7-20)21-9-14-25-26(16-21)30-19-32(28(25)34)17-23-8-4-5-15-29-23/h1-16,19H,17-18H2,(H,31,33) |
| InChIKey | QJFTXEOACAFIHR-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |