C17H17N3O2 — CID 110785783
3-methoxy-N-[(1-methylbenzimidazol-5-yl)methyl]benzamide (PubChem CID 110785783) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is 3-methoxy-N-[(1-methylbenzimidazol-5-yl)methyl]benzamide.
| Compound Name | 3-methoxy-N-[(1-methylbenzimidazol-5-yl)methyl]benzamide |
|---|---|
| PubChem CID | 110785783 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 3-methoxy-N-[(1-methylbenzimidazol-5-yl)methyl]benzamide |
| SMILES | COc1cccc(C(=O)NCc2ccc3c(c2)ncn3C)c1 |
| InChI | InChI=1S/C17H17N3O2/c1-20-11-19-15-8-12(6-7-16(15)20)10-18-17(21)13-4-3-5-14(9-13)22-2/h3-9,11H,10H2,1-2H3,(H,18,21) |
| InChIKey | WMGSHTWNXPWIPA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |