C11H13N3OS — CID 115167209
N-[(1-methylbenzimidazol-5-yl)methyl]-2-sulfanylacetamide (PubChem CID 115167209) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is N-[(1-methylbenzimidazol-5-yl)methyl]-2-sulfanylacetamide.
| Compound Name | N-[(1-methylbenzimidazol-5-yl)methyl]-2-sulfanylacetamide |
|---|---|
| PubChem CID | 115167209 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | N-[(1-methylbenzimidazol-5-yl)methyl]-2-sulfanylacetamide |
| SMILES | Cn1cnc2cc(CNC(=O)CS)ccc21 |
| InChI | InChI=1S/C11H13N3OS/c1-14-7-13-9-4-8(2-3-10(9)14)5-12-11(15)6-16/h2-4,7,16H,5-6H2,1H3,(H,12,15) |
| InChIKey | MKIQVZUQMZSUQJ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|