C18H21N5O — CID 166313203
1-(5-ethyl-2-methyl-4-pyridinyl)-3-[(1-methylbenzimidazol-5-yl)methyl]urea (PubChem CID 166313203) has the molecular formula C18H21N5O and a molecular weight of 323.40 g/mol. Its IUPAC name is 1-(5-ethyl-2-methyl-4-pyridinyl)-3-[(1-methylbenzimidazol-5-yl)methyl]urea.
| Compound Name | 1-(5-ethyl-2-methyl-4-pyridinyl)-3-[(1-methylbenzimidazol-5-yl)methyl]urea |
|---|---|
| PubChem CID | 166313203 |
| Molecular Formula | C18H21N5O |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 1-(5-ethyl-2-methyl-4-pyridinyl)-3-[(1-methylbenzimidazol-5-yl)methyl]urea |
| SMILES | CCc1cnc(C)cc1NC(=O)NCc1ccc2c(c1)ncn2C |
| InChI | InChI=1S/C18H21N5O/c1-4-14-10-19-12(2)7-15(14)22-18(24)20-9-13-5-6-17-16(8-13)21-11-23(17)3/h5-8,10-11H,4,9H2,1-3H3,(H2,19,20,22,24) |
| InChIKey | MXJKLINSIGJFHE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |