C25H20N2O6 — CID 11988626
4-[[6-[2-(4-methoxyphenyl)acetyl]oxy-4-oxoquinazolin-3-yl]methyl]benzoic acid (PubChem CID 11988626) has the molecular formula C25H20N2O6 and a molecular weight of 444.44 g/mol. Its IUPAC name is 4-[[6-[2-(4-methoxyphenyl)acetyl]oxy-4-oxoquinazolin-3-yl]methyl]benzoic acid.
| Compound Name | 4-[[6-[2-(4-methoxyphenyl)acetyl]oxy-4-oxoquinazolin-3-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 11988626 |
| Molecular Formula | C25H20N2O6 |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 4-[[6-[2-(4-methoxyphenyl)acetyl]oxy-4-oxoquinazolin-3-yl]methyl]benzoic acid |
| SMILES | COc1ccc(CC(=O)Oc2ccc3ncn(Cc4ccc(C(=O)O)cc4)c(=O)c3c2)cc1 |
| InChI | InChI=1S/C25H20N2O6/c1-32-19-8-4-16(5-9-19)12-23(28)33-20-10-11-22-21(13-20)24(29)27(15-26-22)14-17-2-6-18(7-3-17)25(30)31/h2-11,13,15H,12,14H2,1H3,(H,30,31) |
| InChIKey | UWWAUEVJDALVAW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|