C25H21N3O3S — CID 22482160
6-[3-(3-methylphenyl)prop-1-ynyl]-3-[(4-methylsulfonylphenyl)methyl]pyrido[3,4-d]pyrimidin-4-one (PubChem CID 22482160) has the molecular formula C25H21N3O3S and a molecular weight of 443.53 g/mol. Its IUPAC name is 6-[3-(3-methylphenyl)prop-1-ynyl]-3-[(4-methylsulfonylphenyl)methyl]pyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 6-[3-(3-methylphenyl)prop-1-ynyl]-3-[(4-methylsulfonylphenyl)methyl]pyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 22482160 |
| Molecular Formula | C25H21N3O3S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 6-[3-(3-methylphenyl)prop-1-ynyl]-3-[(4-methylsulfonylphenyl)methyl]pyrido[3,4-d]pyrimidin-4-one |
| SMILES | Cc1cccc(CC#Cc2cc3c(=O)n(Cc4ccc(S(C)(=O)=O)cc4)cnc3cn2)c1 |
| InChI | InChI=1S/C25H21N3O3S/c1-18-5-3-6-19(13-18)7-4-8-21-14-23-24(15-26-21)27-17-28(25(23)29)16-20-9-11-22(12-10-20)32(2,30)31/h3,5-6,9-15,17H,7,16H2,1-2H3 |
| InChIKey | NXUVFAWXANIBLZ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 81.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|