C24H16FN3O3 — CID 22482135
4-[[6-[3-(3-fluorophenyl)prop-1-ynyl]-4-oxopyrido[3,4-d]pyrimidin-3-yl]methyl]benzoic acid (PubChem CID 22482135) has the molecular formula C24H16FN3O3 and a molecular weight of 413.41 g/mol. Its IUPAC name is 4-[[6-[3-(3-fluorophenyl)prop-1-ynyl]-4-oxopyrido[3,4-d]pyrimidin-3-yl]methyl]benzoic acid.
| Compound Name | 4-[[6-[3-(3-fluorophenyl)prop-1-ynyl]-4-oxopyrido[3,4-d]pyrimidin-3-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 22482135 |
| Molecular Formula | C24H16FN3O3 |
| Molecular Weight | 413.41 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 4-[[6-[3-(3-fluorophenyl)prop-1-ynyl]-4-oxopyrido[3,4-d]pyrimidin-3-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(Cn2cnc3cnc(C#CCc4cccc(F)c4)cc3c2=O)cc1 |
| InChI | InChI=1S/C24H16FN3O3/c25-19-5-1-3-16(11-19)4-2-6-20-12-21-22(13-26-20)27-15-28(23(21)29)14-17-7-9-18(10-8-17)24(30)31/h1,3,5,7-13,15H,4,14H2,(H,30,31) |
| InChIKey | GLGANHPNXGPYPE-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|