C24H20N3O3S+ — CID 142804208
CID 142804208 (PubChem CID 142804208) has the molecular formula C24H20N3O3S+ and a molecular weight of 430.51 g/mol.
| Compound Name | CID 142804208 |
|---|---|
| PubChem CID | 142804208 |
| Molecular Formula | C24H20N3O3S+ |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | — |
| SMILES | N[S+](=O)(O)c1ccc(Cn2cnc3ccc(C#CCc4ccccc4)cc3c2=O)cc1 |
| InChI | InChI=1S/C24H19N3O3S/c25-31(29,30)21-12-9-20(10-13-21)16-27-17-26-23-14-11-19(15-22(23)24(27)28)8-4-7-18-5-2-1-3-6-18/h1-3,5-6,9-15,17H,7,16H2,(H2-,25,29,30)/p+1 |
| InChIKey | HEMQZDGXJJOGIL-UHFFFAOYSA-O |
| XLogP | 3.24 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|