C13H9FN2OS — CID 18195406
3-[(3-fluorophenyl)methyl]thieno[2,3-d]pyrimidin-4-one (PubChem CID 18195406) has the molecular formula C13H9FN2OS and a molecular weight of 260.29 g/mol. Its IUPAC name is 3-[(3-fluorophenyl)methyl]thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-[(3-fluorophenyl)methyl]thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 18195406 |
| Molecular Formula | C13H9FN2OS |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 3-[(3-fluorophenyl)methyl]thieno[2,3-d]pyrimidin-4-one |
| SMILES | O=c1c2ccsc2ncn1Cc1cccc(F)c1 |
| InChI | InChI=1S/C13H9FN2OS/c14-10-3-1-2-9(6-10)7-16-8-15-12-11(13(16)17)4-5-18-12/h1-6,8H,7H2 |
| InChIKey | ABVJAMIGWHTBHY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |