C13H10N4O3S — CID 62207639
3-[(4-amino-3-nitrophenyl)methyl]thieno[2,3-d]pyrimidin-4-one (PubChem CID 62207639) has the molecular formula C13H10N4O3S and a molecular weight of 302.31 g/mol. Its IUPAC name is 3-[(4-amino-3-nitrophenyl)methyl]thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-[(4-amino-3-nitrophenyl)methyl]thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 62207639 |
| Molecular Formula | C13H10N4O3S |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 3-[(4-amino-3-nitrophenyl)methyl]thieno[2,3-d]pyrimidin-4-one |
| SMILES | Nc1ccc(Cn2cnc3sccc3c2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H10N4O3S/c14-10-2-1-8(5-11(10)17(19)20)6-16-7-15-12-9(13(16)18)3-4-21-12/h1-5,7H,6,14H2 |
| InChIKey | SOOYMISYEZPHQS-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|