C16H12N4OS — CID 42092857
3-[(4-pyrazol-1-ylphenyl)methyl]thieno[2,3-d]pyrimidin-4-one (PubChem CID 42092857) has the molecular formula C16H12N4OS and a molecular weight of 308.37 g/mol. Its IUPAC name is 3-[(4-pyrazol-1-ylphenyl)methyl]thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-[(4-pyrazol-1-ylphenyl)methyl]thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 42092857 |
| Molecular Formula | C16H12N4OS |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 3-[(4-pyrazol-1-ylphenyl)methyl]thieno[2,3-d]pyrimidin-4-one |
| SMILES | O=c1c2ccsc2ncn1Cc1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C16H12N4OS/c21-16-14-6-9-22-15(14)17-11-19(16)10-12-2-4-13(5-3-12)20-8-1-7-18-20/h1-9,11H,10H2 |
| InChIKey | PMZAQONNFKFMCH-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |