C19H18N4O2S — CID 165035279
1-[[4-(amino-methylidene-oxo-λ6-sulfanyl)phenyl]methyl]-7-methoxyimidazo[4,5-c]quinoline (PubChem CID 165035279) has the molecular formula C19H18N4O2S and a molecular weight of 366.45 g/mol. Its IUPAC name is 1-[[4-(amino-methylidene-oxo-λ6-sulfanyl)phenyl]methyl]-7-methoxyimidazo[4,5-c]quinoline.
| Compound Name | 1-[[4-(amino-methylidene-oxo-λ6-sulfanyl)phenyl]methyl]-7-methoxyimidazo[4,5-c]quinoline |
|---|---|
| PubChem CID | 165035279 |
| Molecular Formula | C19H18N4O2S |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 1-[[4-(amino-methylidene-oxo-λ6-sulfanyl)phenyl]methyl]-7-methoxyimidazo[4,5-c]quinoline |
| SMILES | C=S(N)(=O)c1ccc(Cn2cnc3cnc4cc(OC)ccc4c32)cc1 |
| InChI | InChI=1S/C19H18N4O2S/c1-25-14-5-8-16-17(9-14)21-10-18-19(16)23(12-22-18)11-13-3-6-15(7-4-13)26(2,20)24/h3-10,12H,2,11H2,1H3,(H2,20,24) |
| InChIKey | HGZKEMHRPRWNPC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|