About 1-[[4-(amino-methylidene-oxo-λ6-sulfanyl)phenyl]methyl]-7-methoxyimidazo[4,5-c]quinoline
1-[[4-(amino-methylidene-oxo-λ6-sulfanyl)phenyl]methyl]-7-methoxyimidazo[4,5-c]quinoline (PubChem CID 165035279) has the molecular formula C19H18N4O2S
and a molecular weight of 366.45 g/mol. Its IUPAC name is 1-[[4-(amino-methylidene-oxo-λ6-sulfanyl)phenyl]methyl]-7-methoxyimidazo[4,5-c]quinoline.
Molecular Properties
| Compound Name | 1-[[4-(amino-methylidene-oxo-λ6-sulfanyl)phenyl]methyl]-7-methoxyimidazo[4,5-c]quinoline |
| PubChem CID | 165035279 |
| Molecular Formula | C19H18N4O2S |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 1-[[4-(amino-methylidene-oxo-λ6-sulfanyl)phenyl]methyl]-7-methoxyimidazo[4,5-c]quinoline |
| SMILES | C=S(N)(=O)c1ccc(Cn2cnc3cnc4cc(OC)ccc4c32)cc1 |
| InChI | InChI=1S/C19H18N4O2S/c1-25-14-5-8-16-17(9-14)21-10-18-19(16)23(12-22-18)11-13-3-6-15(7-4-13)26(2,20)24/h3-10,12H,2,11H2,1H3,(H2,20,24) |
| InChIKey | HGZKEMHRPRWNPC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[[4-(amino-methylidene-oxo-λ6-sulfanyl)phenyl]methyl]-7-methoxyimidazo[4,5-c]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[4-(amino-methylidene-oxo-λ6-sulfanyl)phenyl]methyl]-7-methoxyimidazo[4,5-c]quinoline?
The IUPAC name of 1-[[4-(amino-methylidene-oxo-λ6-sulfanyl)phenyl]methyl]-7-methoxyimidazo[4,5-c]quinoline (CID 165035279) is 1-[[4-(amino-methylidene-oxo-λ6-sulfanyl)phenyl]methyl]-7-methoxyimidazo[4,5-c]quinoline.
What is the SMILES notation for 1-[[4-(amino-methylidene-oxo-λ6-sulfanyl)phenyl]methyl]-7-methoxyimidazo[4,5-c]quinoline?
The canonical SMILES for 1-[[4-(amino-methylidene-oxo-λ6-sulfanyl)phenyl]methyl]-7-methoxyimidazo[4,5-c]quinoline is C=S(N)(=O)c1ccc(Cn2cnc3cnc4cc(OC)ccc4c32)cc1.
What is the InChIKey of 1-[[4-(amino-methylidene-oxo-λ6-sulfanyl)phenyl]methyl]-7-methoxyimidazo[4,5-c]quinoline?
The InChIKey is HGZKEMHRPRWNPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N4O2S/c1-25-14-5-8-16-17(9-14)21-10-18-19(16)23(12-22-18)11-13-3-6-15(7-4-13)26(2,20)24/h3-10,12H,2,11H2,1H3,(H2,20,24).
What are the key properties of 1-[[4-(amino-methylidene-oxo-λ6-sulfanyl)phenyl]methyl]-7-methoxyimidazo[4,5-c]quinoline?
1-[[4-(amino-methylidene-oxo-λ6-sulfanyl)phenyl]methyl]-7-methoxyimidazo[4,5-c]quinoline has a molecular weight of 366.45 g/mol, XLogP of 2.59, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[4-(amino-methylidene-oxo-λ6-sulfanyl)phenyl]methyl]-7-methoxyimidazo[4,5-c]quinoline is sourced from PubChem (CID 165035279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).