C13H12N4O2 — CID 134540798
1-[(4-methoxyphenyl)methyl]-6H-imidazo[4,5-d]pyridazin-7-one (PubChem CID 134540798) has the molecular formula C13H12N4O2 and a molecular weight of 256.26 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-6H-imidazo[4,5-d]pyridazin-7-one.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-6H-imidazo[4,5-d]pyridazin-7-one |
|---|---|
| PubChem CID | 134540798 |
| Molecular Formula | C13H12N4O2 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-6H-imidazo[4,5-d]pyridazin-7-one |
| SMILES | COc1ccc(Cn2cnc3cn[nH]c(=O)c32)cc1 |
| InChI | InChI=1S/C13H12N4O2/c1-19-10-4-2-9(3-5-10)7-17-8-14-11-6-15-16-13(18)12(11)17/h2-6,8H,7H2,1H3,(H,16,18) |
| InChIKey | OISHLWLUMNXOLD-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |