C18H17N3O4 — CID 21004606
3-[(2,3-dihydro-1,4-benzodioxin-6-ylamino)methyl]-7-methoxyquinazolin-4-one (PubChem CID 21004606) has the molecular formula C18H17N3O4 and a molecular weight of 339.35 g/mol. Its IUPAC name is 3-[(2,3-dihydro-1,4-benzodioxin-6-ylamino)methyl]-7-methoxyquinazolin-4-one.
| Compound Name | 3-[(2,3-dihydro-1,4-benzodioxin-6-ylamino)methyl]-7-methoxyquinazolin-4-one |
|---|---|
| PubChem CID | 21004606 |
| Molecular Formula | C18H17N3O4 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 3-[(2,3-dihydro-1,4-benzodioxin-6-ylamino)methyl]-7-methoxyquinazolin-4-one |
| SMILES | COc1ccc2c(=O)n(CNc3ccc4c(c3)OCCO4)cnc2c1 |
| InChI | InChI=1S/C18H17N3O4/c1-23-13-3-4-14-15(9-13)20-11-21(18(14)22)10-19-12-2-5-16-17(8-12)25-7-6-24-16/h2-5,8-9,11,19H,6-7,10H2,1H3 |
| InChIKey | ASHLURJYBBOOBP-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|