C19H18N2O4 — CID 856569
3-[(2,3-dihydro-1,4-benzodioxin-6-ylamino)methyl]-6-methoxy-1H-quinolin-2-one (PubChem CID 856569) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is 3-[(2,3-dihydro-1,4-benzodioxin-6-ylamino)methyl]-6-methoxy-1H-quinolin-2-one.
| Compound Name | 3-[(2,3-dihydro-1,4-benzodioxin-6-ylamino)methyl]-6-methoxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 856569 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 3-[(2,3-dihydro-1,4-benzodioxin-6-ylamino)methyl]-6-methoxy-1H-quinolin-2-one |
| SMILES | COc1ccc2[nH]c(=O)c(CNc3ccc4c(c3)OCCO4)cc2c1 |
| InChI | InChI=1S/C19H18N2O4/c1-23-15-3-4-16-12(9-15)8-13(19(22)21-16)11-20-14-2-5-17-18(10-14)25-7-6-24-17/h2-5,8-10,20H,6-7,11H2,1H3,(H,21,22) |
| InChIKey | IZHUMFOCHVANLO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 72.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|