C19H20N2O3 — CID 95855590
3-[(3,4-dimethoxyanilino)methyl]-6-methyl-1H-quinolin-2-one (PubChem CID 95855590) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is 3-[(3,4-dimethoxyanilino)methyl]-6-methyl-1H-quinolin-2-one.
| Compound Name | 3-[(3,4-dimethoxyanilino)methyl]-6-methyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 95855590 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 3-[(3,4-dimethoxyanilino)methyl]-6-methyl-1H-quinolin-2-one |
| SMILES | COc1ccc(NCc2cc3cc(C)ccc3[nH]c2=O)cc1OC |
| InChI | InChI=1S/C19H20N2O3/c1-12-4-6-16-13(8-12)9-14(19(22)21-16)11-20-15-5-7-17(23-2)18(10-15)24-3/h4-10,20H,11H2,1-3H3,(H,21,22) |
| InChIKey | WMMILGGHKXYKHJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|