C19H15ClN2O3 — CID 122637181
6-chloro-3-[[(4-methoxy-1-benzofuran-6-yl)amino]methyl]-1H-quinolin-2-one (PubChem CID 122637181) has the molecular formula C19H15ClN2O3 and a molecular weight of 354.79 g/mol. Its IUPAC name is 6-chloro-3-[[(4-methoxy-1-benzofuran-6-yl)amino]methyl]-1H-quinolin-2-one.
| Compound Name | 6-chloro-3-[[(4-methoxy-1-benzofuran-6-yl)amino]methyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 122637181 |
| Molecular Formula | C19H15ClN2O3 |
| Molecular Weight | 354.79 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 6-chloro-3-[[(4-methoxy-1-benzofuran-6-yl)amino]methyl]-1H-quinolin-2-one |
| SMILES | COc1cc(NCc2cc3cc(Cl)ccc3[nH]c2=O)cc2occc12 |
| InChI | InChI=1S/C19H15ClN2O3/c1-24-17-8-14(9-18-15(17)4-5-25-18)21-10-12-6-11-7-13(20)2-3-16(11)22-19(12)23/h2-9,21H,10H2,1H3,(H,22,23) |
| InChIKey | DWCXZGJGJLJGDO-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.79 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |