C20H22ClN5O3 — CID 145174638
N-[2-[(6-chloro-2-oxo-1H-quinolin-3-yl)methylamino]-5-methoxypyrimidin-4-yl]-N-(2-methylpropyl)formamide (PubChem CID 145174638) has the molecular formula C20H22ClN5O3 and a molecular weight of 415.88 g/mol. Its IUPAC name is N-[2-[(6-chloro-2-oxo-1H-quinolin-3-yl)methylamino]-5-methoxypyrimidin-4-yl]-N-(2-methylpropyl)formamide.
| Compound Name | N-[2-[(6-chloro-2-oxo-1H-quinolin-3-yl)methylamino]-5-methoxypyrimidin-4-yl]-N-(2-methylpropyl)formamide |
|---|---|
| PubChem CID | 145174638 |
| Molecular Formula | C20H22ClN5O3 |
| Molecular Weight | 415.88 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | N-[2-[(6-chloro-2-oxo-1H-quinolin-3-yl)methylamino]-5-methoxypyrimidin-4-yl]-N-(2-methylpropyl)formamide |
| SMILES | COc1cnc(NCc2cc3cc(Cl)ccc3[nH]c2=O)nc1N(C=O)CC(C)C |
| InChI | InChI=1S/C20H22ClN5O3/c1-12(2)10-26(11-27)18-17(29-3)9-23-20(25-18)22-8-14-6-13-7-15(21)4-5-16(13)24-19(14)28/h4-7,9,11-12H,8,10H2,1-3H3,(H,24,28)(H,22,23,25) |
| InChIKey | QSYRVNBAMPBAKD-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.88 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|