C18H20ClN5OS — CID 146240371
6-chloro-3-[[[4-[methylsulfanyl(propan-2-yl)amino]pyrimidin-2-yl]amino]methyl]-1H-quinolin-2-one (PubChem CID 146240371) has the molecular formula C18H20ClN5OS and a molecular weight of 389.91 g/mol. Its IUPAC name is 6-chloro-3-[[[4-[methylsulfanyl(propan-2-yl)amino]pyrimidin-2-yl]amino]methyl]-1H-quinolin-2-one.
| Compound Name | 6-chloro-3-[[[4-[methylsulfanyl(propan-2-yl)amino]pyrimidin-2-yl]amino]methyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 146240371 |
| Molecular Formula | C18H20ClN5OS |
| Molecular Weight | 389.91 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 6-chloro-3-[[[4-[methylsulfanyl(propan-2-yl)amino]pyrimidin-2-yl]amino]methyl]-1H-quinolin-2-one |
| SMILES | CSN(c1ccnc(NCc2cc3cc(Cl)ccc3[nH]c2=O)n1)C(C)C |
| InChI | InChI=1S/C18H20ClN5OS/c1-11(2)24(26-3)16-6-7-20-18(23-16)21-10-13-8-12-9-14(19)4-5-15(12)22-17(13)25/h4-9,11H,10H2,1-3H3,(H,22,25)(H,20,21,23) |
| InChIKey | RQOHYWVDTWNHJR-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.91 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|