C21H26ClN5OS — CID 145049135
6-chloro-3-[[[4-[2-methylpropylsulfanyl(propan-2-yl)amino]pyrimidin-2-yl]amino]methyl]-1H-quinolin-2-one (PubChem CID 145049135) has the molecular formula C21H26ClN5OS and a molecular weight of 431.99 g/mol. Its IUPAC name is 6-chloro-3-[[[4-[2-methylpropylsulfanyl(propan-2-yl)amino]pyrimidin-2-yl]amino]methyl]-1H-quinolin-2-one.
| Compound Name | 6-chloro-3-[[[4-[2-methylpropylsulfanyl(propan-2-yl)amino]pyrimidin-2-yl]amino]methyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 145049135 |
| Molecular Formula | C21H26ClN5OS |
| Molecular Weight | 431.99 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 6-chloro-3-[[[4-[2-methylpropylsulfanyl(propan-2-yl)amino]pyrimidin-2-yl]amino]methyl]-1H-quinolin-2-one |
| SMILES | CC(C)CSN(c1ccnc(NCc2cc3cc(Cl)ccc3[nH]c2=O)n1)C(C)C |
| InChI | InChI=1S/C21H26ClN5OS/c1-13(2)12-29-27(14(3)4)19-7-8-23-21(26-19)24-11-16-9-15-10-17(22)5-6-18(15)25-20(16)28/h5-10,13-14H,11-12H2,1-4H3,(H,25,28)(H,23,24,26) |
| InChIKey | VPVBBGFCCDKGSX-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.99 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|