C17H13ClN4O — CID 122637226
6-chloro-3-[(1H-indazol-6-ylamino)methyl]-1H-quinolin-2-one (PubChem CID 122637226) has the molecular formula C17H13ClN4O and a molecular weight of 324.77 g/mol. Its IUPAC name is 6-chloro-3-[(1H-indazol-6-ylamino)methyl]-1H-quinolin-2-one.
| Compound Name | 6-chloro-3-[(1H-indazol-6-ylamino)methyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 122637226 |
| Molecular Formula | C17H13ClN4O |
| Molecular Weight | 324.77 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 6-chloro-3-[(1H-indazol-6-ylamino)methyl]-1H-quinolin-2-one |
| SMILES | O=c1[nH]c2ccc(Cl)cc2cc1CNc1ccc2cn[nH]c2c1 |
| InChI | InChI=1S/C17H13ClN4O/c18-13-2-4-15-11(6-13)5-12(17(23)21-15)8-19-14-3-1-10-9-20-22-16(10)7-14/h1-7,9,19H,8H2,(H,20,22)(H,21,23) |
| InChIKey | RNUMHONQTIYXJR-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 73.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.77 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |