C18H13ClN2O3 — CID 122637068
6-chloro-3-[[(3-oxo-1H-2-benzofuran-5-yl)amino]methyl]-1H-quinolin-2-one (PubChem CID 122637068) has the molecular formula C18H13ClN2O3 and a molecular weight of 340.77 g/mol. Its IUPAC name is 6-chloro-3-[[(3-oxo-1H-2-benzofuran-5-yl)amino]methyl]-1H-quinolin-2-one.
| Compound Name | 6-chloro-3-[[(3-oxo-1H-2-benzofuran-5-yl)amino]methyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 122637068 |
| Molecular Formula | C18H13ClN2O3 |
| Molecular Weight | 340.77 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 6-chloro-3-[[(3-oxo-1H-2-benzofuran-5-yl)amino]methyl]-1H-quinolin-2-one |
| SMILES | O=C1OCc2ccc(NCc3cc4cc(Cl)ccc4[nH]c3=O)cc21 |
| InChI | InChI=1S/C18H13ClN2O3/c19-13-2-4-16-11(6-13)5-12(17(22)21-16)8-20-14-3-1-10-9-24-18(23)15(10)7-14/h1-7,20H,8-9H2,(H,21,22) |
| InChIKey | ZKFFIBWEUOSZKB-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.77 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |